4,4,6-trimethyl-2-[1-(trifluoromethyl)vinyl]-1,3,2-dioxaborinane 1-(Trifluoromethyl)vinylboronic acid hexylene glycol ester CAS: 1011460-68-6 MDL: MFCD08669623
5 g (T2030)
4,4,6-trimethyl-2-[1-(trifluoromethyl)vinyl]-1,3,2-dioxaborinane 1-(Trifluoromethyl)vinylboronic acid hexylene glycol ester CAS: 1011460-68-6 MDL: MFCD08669623
- Fast Global Shipping
- Guaranteed Purity
- Need smaller sizes or bulk? Contact us!
SKU: T2030-5g
Category: Boronic Esters
| Weight | 5 g |
|---|---|
| Categories | Boronic Esters |
| Scaffold/Subcategory | Boronic Esters |
| CAS # | [1011460-68-6] |
| Purity % | 98% |
| Smiles | CC1CC(C)(C)OB(O1)C(=C)C(F)(F)F |
| Molecular Weight | 222.01 |
| Molecular Formula | C9H14BF3O2 |
| Functional Groups | Alkene, Trifluoromethyl, Vinyl |